CAS 79698-48-9
:3-Chloro-4-ethylpyridine
Description:
3-Chloro-4-ethylpyridine is an organic compound belonging to the class of pyridines, which are heterocyclic aromatic compounds containing a nitrogen atom in the ring. This particular compound features a chlorine atom and an ethyl group attached to the pyridine ring, specifically at the 3 and 4 positions, respectively. It is typically a colorless to pale yellow liquid with a characteristic odor. The presence of the chlorine atom contributes to its reactivity, making it useful in various chemical syntheses and applications, including pharmaceuticals and agrochemicals. 3-Chloro-4-ethylpyridine is soluble in organic solvents and exhibits moderate stability under standard conditions. Its chemical properties include the ability to undergo nucleophilic substitution reactions due to the electrophilic nature of the chlorine atom. Safety data indicates that, like many chlorinated compounds, it should be handled with care, as it may pose health risks upon exposure. Proper storage and handling protocols are essential to mitigate any potential hazards associated with this compound.
Formula:C7H8ClN
InChI:InChI=1S/C7H8ClN/c1-2-6-3-4-9-5-7(6)8/h3-5H,2H2,1H3
InChI key:InChIKey=PLVLILLMAPIEAB-UHFFFAOYSA-N
SMILES:C(C)C=1C(Cl)=CN=CC1
Synonyms:- Pyridine, 3-chloro-4-ethyl-
- 3-Chloro-4-ethylpyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
