CymitQuimica logo

CAS 79703-02-9

:

(2S,5R,6S)-6-bromo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid 4-oxide

Description:
The chemical substance known as "(2S,5R,6S)-6-bromo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid 4-oxide," with the CAS number 79703-02-9, is a bicyclic compound featuring a thiazolidine ring structure. This compound is characterized by the presence of a bromine atom, a carboxylic acid functional group, and a keto group, contributing to its reactivity and potential biological activity. The stereochemistry indicated by the (2S,5R,6S) configuration suggests specific spatial arrangements of its substituents, which can significantly influence its pharmacological properties. The compound's unique structure may allow it to interact with biological targets, making it of interest in medicinal chemistry. Additionally, the presence of sulfur in the thiazolidine ring can impart distinct chemical properties, such as increased lipophilicity or altered metabolic pathways. Overall, this compound's structural features suggest potential applications in drug development or as a biochemical probe, although specific biological activities would require further investigation.
Formula:C8H10BrNO4S
InChI:InChI=1/C8H10BrNO4S/c1-8(2)4(7(12)13)10-5(11)3(9)6(10)15(8)14/h3-4,6H,1-2H3,(H,12,13)/t3-,4-,6+,15?/m0/s1
Synonyms:
  • Sulbactam Impurity 3
  • 6-bromopenicillanic acid S-sulfoxide
  • See more synonyms
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.