
CAS 797030-66-1
:N-(1-Naphthalenylmethyl)-2-furanmethanamine
Description:
N-(1-Naphthalenylmethyl)-2-furanmethanamine, identified by its CAS number 797030-66-1, is a chemical compound characterized by its unique structure that combines a naphthalene moiety with a furan and an amine group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, which may include moderate to high lipophilicity due to the presence of the naphthalene ring. The furan ring contributes to its potential reactivity, particularly in electrophilic substitution reactions. As an amine, it may also participate in hydrogen bonding, influencing its solubility and interaction with biological systems. The compound's specific applications and biological activity can vary, but it may be of interest in medicinal chemistry for its potential pharmacological properties. Overall, the characteristics of N-(1-Naphthalenylmethyl)-2-furanmethanamine suggest a versatile compound with potential utility in various chemical and biological contexts.
Formula:C16H15NO
InChI:InChI=1S/C16H15NO/c1-2-9-16-13(5-1)6-3-7-14(16)11-17-12-15-8-4-10-18-15/h1-10,17H,11-12H2
InChI key:InChIKey=FLNWBNLZGZPQSG-UHFFFAOYSA-N
SMILES:C(NCC1=CC=CO1)C=2C3=C(C=CC2)C=CC=C3
Synonyms:- N-(1-Naphthalenylmethyl)-2-furanmethanamine
- (Furan-2-ylmethyl)(naphthalen-1-ylmethyl)amine
- 2-Furanmethanamine, N-(1-naphthalenylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.