CAS 797032-05-4
:Ethyl 3-nitropyridin-4-yl(cyclopropyl)carbamate
Description:
Ethyl 3-nitropyridin-4-yl(cyclopropyl)carbamate is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a nitro group and a carbamate functional group. The presence of the ethyl group and the cyclopropyl moiety contributes to its distinct chemical properties. This compound is likely to exhibit moderate polarity due to the presence of both hydrophilic (carbamate) and hydrophobic (cyclopropyl) components. It may participate in hydrogen bonding due to the carbamate group, influencing its solubility in various solvents. The nitro group can impart additional reactivity, making it a potential candidate for further chemical transformations. Ethyl 3-nitropyridin-4-yl(cyclopropyl)carbamate may also exhibit biological activity, which could be of interest in pharmaceutical research. Its specific applications and behavior in biological systems would depend on further studies, including its interaction with biological targets and its pharmacokinetic properties. Overall, this compound represents a complex structure with potential utility in medicinal chemistry and related fields.
Formula:C11H13N3O4
InChI:InChI=1/C11H13N3O4/c1-2-18-11(15)13(8-3-4-8)9-5-6-12-7-10(9)14(16)17/h5-8H,2-4H2,1H3
SMILES:CCOC(=O)N(C1CC1)c1ccncc1N(=O)=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
