CAS 79721-05-4
:N-[(5-ethyl-8-oxo-5,8-dihydro[1,3]dioxolo[4,5-g]quinolin-7-yl)carbonyl]-L-alanine
Description:
N-[(5-ethyl-8-oxo-5,8-dihydro[1,3]dioxolo[4,5-g]quinolin-7-yl)carbonyl]-L-alanine is a synthetic compound characterized by its complex structure, which includes a quinoline derivative fused with a dioxole ring. This compound features a carbonyl group linked to an L-alanine moiety, indicating its potential role in biological systems, possibly as a peptide or a drug candidate. The presence of the ethyl group and the oxo functionality contributes to its chemical reactivity and solubility properties. The compound's unique structure may impart specific pharmacological activities, making it of interest in medicinal chemistry. Its CAS number, 79721-05-4, allows for precise identification in chemical databases. As with many compounds of this nature, understanding its stability, solubility, and interaction with biological targets is crucial for evaluating its potential applications in pharmaceuticals or biochemistry. Further studies would be necessary to elucidate its full range of properties and potential uses.
Formula:C16H16N2O6
InChI:InChI=1/C16H16N2O6/c1-3-18-6-10(15(20)17-8(2)16(21)22)14(19)9-4-12-13(5-11(9)18)24-7-23-12/h4-6,8H,3,7H2,1-2H3,(H,17,20)(H,21,22)/t8-/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.