CymitQuimica logo

CAS 797755-07-8

:

[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetic acid

Description:
[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetic acid is an organic compound characterized by its unique structure, which includes a phenyl ring substituted with a boron-containing dioxaborolane moiety. This compound typically exhibits properties associated with both acidic and boron-containing functionalities, making it of interest in various chemical applications, including organic synthesis and medicinal chemistry. The presence of the dioxaborolane group suggests potential reactivity in cross-coupling reactions, which are valuable in the formation of carbon-carbon bonds. Additionally, the acetic acid functional group contributes to its acidity and solubility in polar solvents. The compound may also exhibit specific biological activities, depending on its interactions with biological systems, which could be explored for pharmaceutical applications. Overall, its structural features and functional groups make it a versatile compound in both synthetic and applied chemistry contexts.
Formula:C14H19BO4
InChI:InChI=1/C14H19BO4/c1-13(2)14(3,4)19-15(18-13)11-7-5-10(6-8-11)9-12(16)17/h5-8H,9H2,1-4H3,(H,16,17)
InChI key:FNLWHBHWDXCWHV-UHFFFAOYSA-N
SMILES:CC1(C)C(C)(C)OB(c2ccc(cc2)CC(=O)O)O1
Synonyms:
  • Phenylacetic acid-4-boronic acid pinacol ester
  • 4-(Carboxymethyl)phenylboronic acid pinacol ester
Found 8 products.