CAS 797762-24-4

2-(Diphenylmethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

Description:

2-(Diphenylmethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is an organoboron compound characterized by its unique dioxaborolane ring structure, which incorporates boron and oxygen atoms. This compound features a tetramethyl substitution pattern, contributing to its steric bulk and potentially influencing its reactivity and solubility. The presence of the diphenylmethyl group enhances its stability and may provide interesting electronic properties due to the resonance effects of the phenyl rings. Typically, compounds of this nature are utilized in organic synthesis, particularly in cross-coupling reactions, due to the reactivity of the boron atom. The dioxaborolane structure allows for the formation of stable complexes with various nucleophiles, making it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, the compound's physical properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and solvents used. Overall, this compound exemplifies the versatility and utility of boron-containing compounds in modern organic chemistry.

Formula: C₁₉H₂₃BO₂

InChI: InChI=1S/C19H23BO2/c1-18(2)19(3,4)22-20(21-18)17(15-11-7-5-8-12-15)16-13-9-6-10-14-16/h5-14,17H,1-4H3

InChI key: InChIKey=PRJXYOOTVRHBKZ-UHFFFAOYSA-N

SMILES: C(B1OC(C)(C)C(C)(C)O1)(C2=CC=CC=C2)C3=CC=CC=C3

Synonyms:

• 2-(Diphenylmethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
• 1,3,2-Dioxaborolane, 2-(diphenylmethyl)-4,4,5,5-tetramethyl-

1,3,2-Dioxaborolane, 2-(diphenylmethyl)-4,4,5,5-tetramethyl-

CAS: 797762-24-4

Formula: C₁₉H₂₃BO₂

Molecular weight: 294.1957

Ref: IN-DA01PJ1S