CAS 797767-52-3

4-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-ylaniline

Description:

4-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-ylaniline is a heterocyclic compound characterized by the presence of both triazole and thiadiazole rings, which contribute to its unique chemical properties. This compound typically exhibits a complex structure that includes an aniline moiety, enhancing its potential for various biological activities. The presence of nitrogen and sulfur atoms in its rings can influence its reactivity and solubility, making it of interest in medicinal chemistry and material science. It may exhibit properties such as antimicrobial, antifungal, or anticancer activities, depending on its specific interactions with biological targets. Additionally, the compound's stability, melting point, and solubility can vary based on its molecular structure and the presence of substituents. As a synthetic compound, it may be produced through specific chemical reactions involving precursors that contain the requisite functional groups. Overall, 4-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-ylaniline represents a class of compounds that are valuable for research and potential applications in pharmaceuticals.

Formula: C₉H₇N₅S

InChI: InChI=1/C9H7N5S/c10-7-3-1-6(2-4-7)8-13-14-5-11-12-9(14)15-8/h1-5H,10H2

SMILES: c1cc(ccc1c1nn2cnnc2s1)N

Synonyms:

• 4-([1,2,4]Triazolo[3,4-b][1,3,4]thiadiazol-6-yl)aniline
• Benzenamine, 4-(1,2,4-triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-

(4-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-ylphenyl)amine

CAS: 797767-52-3

Formula: C₉H₇N₅S

Molecular weight: 217.2504

Ref: IN-DA008LD4

4-[1,2,4]Triazolo[3,4- b ][1,3,4]thiadiazol-6-yl-phenylamine

CAS: 797767-52-3

Purity: 95.0%

Molecular weight: 217.25

Ref: 10-F030693