CAS 797807-53-5: 5-(1H-1,2,4-triazol-5-ylsulfanyl)furan-2-carbaldehyde

Description: 5-(1H-1,2,4-triazol-5-ylsulfanyl)furan-2-carbaldehyde is a chemical compound characterized by its unique structural features, which include a furan ring and a triazole moiety. The presence of the aldehyde functional group contributes to its reactivity, making it a potential candidate for various chemical reactions, such as condensation and nucleophilic addition. The triazole ring, known for its stability and ability to form coordination complexes, may impart biological activity, making this compound of interest in medicinal chemistry. Additionally, the sulfanyl group enhances its potential for forming thiol-related interactions, which can be significant in biological systems. This compound may exhibit properties such as solubility in polar solvents and moderate stability under standard laboratory conditions. Its specific applications could range from pharmaceuticals to agrochemicals, depending on the biological activity and reactivity of the compound. Overall, 5-(1H-1,2,4-triazol-5-ylsulfanyl)furan-2-carbaldehyde represents a versatile structure with potential implications in various fields of chemistry and biology.

Formula: C₇H₅N₃O₂S

InChI: InChI=1/C7H5N3O2S/c11-3-5-1-2-6(12-5)13-7-8-4-9-10-7/h1-4H,(H,8,9,10)

Synonyms:

• 2-Furancarboxaldehyde, 5-(1H-1,2,4-triazol-3-ylthio)-
• 5-(1H-1,2,4-Triazol-3-ylsulfanyl)-2-furaldehyde

5-(1 H -[1,2,4]Triazol-3-ylsulfanyl)-furan-2-carbaldehyde

CAS: 797807-53-5

• Purity: 95.0%
• Molecular weight: 195.1999969482422

5-(4H-1,2,4-Triazol-3-ylthio)-2-furaldehyde

CAS: 797807-53-5

Please enquire for more information about 5-(4H-1,2,4-Triazol-3-ylthio)-2-furaldehyde including the price, delivery time and more detailed …

• Formula: C₇H₅N₃O₂S
• Purity: Min. 95%
• Molecular weight: 195.2 g/mol