CAS 797812-91-0

[2-(propan-2-yl)-1H-benzimidazol-1-yl]acetic acid

Description:

[2-(propan-2-yl)-1H-benzimidazol-1-yl]acetic acid is a chemical compound characterized by its unique structure, which includes a benzimidazole moiety and an acetic acid functional group. This compound typically exhibits properties associated with both the benzimidazole and carboxylic acid functionalities, such as potential biological activity and solubility in polar solvents. The presence of the isopropyl group enhances its lipophilicity, which may influence its pharmacokinetic properties. It may also participate in hydrogen bonding due to the carboxylic acid group, affecting its interactions in biological systems. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Additionally, its CAS number, 797812-91-0, allows for easy identification and reference in chemical databases. Overall, this compound represents a class of benzimidazole derivatives that may possess interesting therapeutic properties, warranting further investigation in drug development and related fields.

Formula: C₁₂H₁₄N₂O₂

InChI: InChI=1/C12H14N2O2/c1-8(2)12-13-9-5-3-4-6-10(9)14(12)7-11(15)16/h3-6,8H,7H2,1-2H3,(H,15,16)

SMILES: CC(C)c1nc2ccccc2n1CC(=O)O

Synonyms:

• (2-Isopropyl-1H-benzimidazol-1-yl)acetic acid
• 1H-Benzimidazole-1-acetic acid, 2-(1-methylethyl)-

(2-Isopropyl-benzoimidazol-1-yl)-acetic acid

CAS: 797812-91-0

Formula: C₁₂H₁₄N₂O₂

Purity: 95.0%

Molecular weight: 218.256

Ref: 10-F028560