CymitQuimica logo

CAS 797812-92-1

:

α-Methyl-2-(1-methylethyl)-1H-benzimidazole-1-acetic acid

Description:
α-Methyl-2-(1-methylethyl)-1H-benzimidazole-1-acetic acid, identified by its CAS number 797812-92-1, is a chemical compound that belongs to the benzimidazole class, which is characterized by a fused benzene and imidazole ring structure. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many benzimidazole derivatives. It may possess biological activity, potentially acting as a pharmaceutical agent or a biochemical probe, although specific pharmacological properties would depend on its interactions at the molecular level. The presence of the α-methyl and isopropyl groups suggests that it may have steric hindrance, influencing its reactivity and binding affinity in biological systems. Additionally, the carboxylic acid functional group contributes to its acidity and potential for forming salts or esters, which can be relevant for its stability and formulation in various applications. Overall, this compound's unique structure and functional groups may confer specific characteristics that are of interest in medicinal chemistry and drug development.
Formula:C13H16N2O2
InChI:InChI=1S/C13H16N2O2/c1-8(2)12-14-10-6-4-5-7-11(10)15(12)9(3)13(16)17/h4-9H,1-3H3,(H,16,17)
InChI key:InChIKey=RJIDVTBWWMPEGE-UHFFFAOYSA-N
SMILES:C(C(O)=O)(C)N1C=2C(N=C1C(C)C)=CC=CC2
Synonyms:
  • α-Methyl-2-(1-methylethyl)-1H-benzimidazole-1-acetic acid
  • 1H-Benzimidazole-1-acetic acid, α-methyl-2-(1-methylethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.