
CAS 797814-03-0
:5-Amino-2-(1-pyrrolidinyl)benzamide
Description:
5-Amino-2-(1-pyrrolidinyl)benzamide is an organic compound characterized by its amine and amide functional groups, which contribute to its chemical reactivity and potential biological activity. The presence of the pyrrolidine ring enhances its lipophilicity and may influence its interaction with biological targets. This compound typically appears as a solid at room temperature and is soluble in polar solvents, which is common for amine-containing compounds. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both an amino group and a benzamide moiety, which are often associated with bioactive compounds. The compound may exhibit various properties such as moderate to high melting points and specific spectral characteristics in techniques like NMR and IR spectroscopy, which can be used for its identification and characterization. Additionally, its safety and handling would require standard precautions typical for organic compounds, especially those containing amines, which can be irritants.
Formula:C11H15N3O
InChI:InChI=1S/C11H15N3O/c12-8-3-4-10(9(7-8)11(13)15)14-5-1-2-6-14/h3-4,7H,1-2,5-6,12H2,(H2,13,15)
InChI key:InChIKey=ZGAKJYKEQQWIJS-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=C(C=CC(N)=C1)N2CCCC2
Synonyms:- 5-Amino-2-(1-pyrrolidinyl)benzamide
- Benzamide, 5-amino-2-(1-pyrrolidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.