CAS 79784-31-9

2-(Bromomethyl)-5-chlorobenzoxazole

Description:

2-(Bromomethyl)-5-chlorobenzoxazole is an organic compound characterized by its unique structure, which includes a benzoxazole ring substituted with bromomethyl and chlorine groups. This compound typically exhibits properties associated with halogenated aromatic compounds, such as increased reactivity due to the presence of the bromomethyl group, which can participate in nucleophilic substitution reactions. The chlorine atom contributes to the compound's overall polarity and can influence its solubility in various solvents. Additionally, benzoxazole derivatives are known for their potential biological activities, including antimicrobial and anticancer properties, making them of interest in medicinal chemistry. The presence of both bromine and chlorine atoms may also enhance the compound's stability and reactivity under certain conditions. Overall, 2-(Bromomethyl)-5-chlorobenzoxazole is a versatile compound with applications in organic synthesis and potential pharmaceutical development, although specific applications would depend on further research into its biological activity and reactivity.

Formula: C₈H₅BrClNO

InChI: InChI=1S/C8H5BrClNO/c9-4-8-11-6-3-5(10)1-2-7(6)12-8/h1-3H,4H2

InChI key: InChIKey=OTHZIVDWWJVZJZ-UHFFFAOYSA-N

SMILES: C(Br)C=1OC=2C(N1)=CC(Cl)=CC2

Synonyms:

• 2-(Bromomethyl)-5-chloro-1,3-benzoxazole
• 2-(Bromomethyl)-5-chlorobenzoxazole
• Benzoxazole, 2-(bromomethyl)-5-chloro-