CAS 79784-47-7

5-(4-fluoro-2-methylphenyl)-1,2,4-triazine-3(2H)-thione

Description:

5-(4-Fluoro-2-methylphenyl)-1,2,4-triazine-3(2H)-thione is a chemical compound characterized by its triazine core, which is a six-membered heterocyclic ring containing three nitrogen atoms. This compound features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, which contributes to its reactivity and potential biological activity. The presence of a 4-fluoro-2-methylphenyl substituent enhances its lipophilicity and may influence its interaction with biological targets. The fluorine atom can also affect the compound's electronic properties, potentially enhancing its stability and reactivity. This compound may exhibit various properties, including antimicrobial or herbicidal activities, making it of interest in agricultural and pharmaceutical research. Its specific applications and behavior in biological systems would depend on further studies, including its solubility, stability under different conditions, and interaction with other molecules. Overall, this compound represents a unique structure that could have significant implications in medicinal chemistry and agrochemicals.

Formula: C₁₀H₈FN₃S

InChI: InChI=1/C10H8FN3S/c1-6-4-7(11)2-3-8(6)9-5-12-14-10(15)13-9/h2-5H,1H3,(H,13,14,15)

SMILES: Cc1cc(ccc1c1cnnc(n1)S)F