CAS 79799-08-9

Ethyl octahydro-1H-indole-2-carboxylate

Description:

Ethyl octahydro-1H-indole-2-carboxylate, identified by its CAS number 79799-08-9, is a chemical compound that belongs to the class of indole derivatives. This substance features a bicyclic structure that includes an indole moiety, which is known for its presence in various natural products and pharmaceuticals. The compound is characterized by its ethyl ester functional group, contributing to its solubility and reactivity. Ethyl octahydro-1H-indole-2-carboxylate is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is often utilized in organic synthesis and may serve as an intermediate in the production of more complex molecules. The compound's properties, such as boiling point, melting point, and specific reactivity, can vary based on its formulation and the presence of other functional groups. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₁H₁₉NO₂

InChI: InChI=1S/C11H19NO2/c1-2-14-11(13)10-7-8-5-3-4-6-9(8)12-10/h8-10,12H,2-7H2,1H3

InChI key: InChIKey=ULGUQTOELKSOAJ-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1CC2C(N1)CCCC2

Synonyms:

• 1H-Indole-2-carboxylic acid, octahydro-, ethyl ester
• Ethyl octahydro-1H-indole-2-carboxylate