CymitQuimica logo

CAS 79823-34-0

:

ethyl (2E)-3-amino-3-(4-phenylpiperazin-1-yl)prop-2-enoate

Description:
Ethyl (2E)-3-amino-3-(4-phenylpiperazin-1-yl)prop-2-enoate, with the CAS number 79823-34-0, is a chemical compound characterized by its unique structure, which includes an ethyl ester group, an amino group, and a piperazine moiety. This compound features a prop-2-enoate backbone, indicating it has an unsaturated carbon-carbon double bond, which contributes to its reactivity and potential applications in organic synthesis. The presence of the piperazine ring, a six-membered heterocyclic structure containing two nitrogen atoms, suggests potential pharmacological properties, as piperazine derivatives are often explored for their biological activity, including antidepressant and antipsychotic effects. The phenyl group attached to the piperazine enhances lipophilicity, potentially influencing the compound's ability to cross biological membranes. Overall, this compound's characteristics make it of interest in medicinal chemistry and drug development, although specific biological activities and applications would require further investigation through empirical studies.
Formula:C15H21N3O2
InChI:InChI=1/C15H21N3O2/c1-2-20-15(19)12-14(16)18-10-8-17(9-11-18)13-6-4-3-5-7-13/h3-7,12H,2,8-11,16H2,1H3/b14-12+
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.