CAS 79835-12-4

N-(6-formyl-1,3-benzodioxol-5-yl)acetamide

Description:

N-(6-formyl-1,3-benzodioxol-5-yl)acetamide is an organic compound characterized by its unique structure, which includes a benzodioxole moiety and an acetamide functional group. This compound typically exhibits properties associated with both aromatic and carbonyl functionalities, contributing to its potential reactivity and interactions. The presence of the formyl group suggests that it can participate in various chemical reactions, such as condensation and nucleophilic addition. The benzodioxole structure is known for its stability and can influence the compound's solubility and polarity. In terms of applications, compounds like N-(6-formyl-1,3-benzodioxol-5-yl)acetamide may be explored in fields such as medicinal chemistry, where they could serve as intermediates or lead compounds in drug development. Additionally, the compound's characteristics may allow it to exhibit biological activity, making it of interest for further research. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings.

Formula: C₁₀H₉NO₄

InChI: InChI=1/C10H9NO4/c1-6(13)11-8-3-10-9(14-5-15-10)2-7(8)4-12/h2-4H,5H2,1H3,(H,11,13)

SMILES: CC(=Nc1cc2c(cc1C=O)OCO2)O

Synonyms:

• Acetamide, N-(6-formyl-1,3-benzodioxol-5-yl)-

N -(6-Formyl-benzo[1,3]dioxol-5-yl)-acetamide

CAS: 79835-12-4

Formula: C₁₀H₉NO₄

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 207.185

Ref: 10-F031129