CymitQuimica logo

CAS 79838-51-0

:

4-[(E)-2-chloro-1-{4-[2-(diethylamino)ethoxy]phenyl}-2-phenylethenyl]phenol

Description:
4-[(E)-2-chloro-1-{4-[2-(diethylamino)ethoxy]phenyl}-2-phenylethenyl]phenol, with the CAS number 79838-51-0, is a synthetic organic compound characterized by its complex structure, which includes multiple functional groups. This compound features a phenolic hydroxyl group, a chloro substituent, and an ethoxy group linked to a diethylamino moiety, contributing to its potential biological activity. The presence of the double bond in the ethenyl group indicates that it may exhibit geometric isomerism, specifically in the E configuration. The diethylamino group suggests that the compound may possess basic properties, which could influence its solubility and interaction with biological systems. Additionally, the compound's structure indicates potential applications in pharmaceuticals or as a dye, given the presence of aromatic rings. Its unique combination of functional groups may also impart specific reactivity and stability characteristics, making it of interest in various chemical and medicinal research contexts. However, detailed studies would be necessary to fully elucidate its properties and potential applications.
Formula:C26H28ClNO2
InChI:InChI=1/C26H28ClNO2/c1-3-28(4-2)18-19-30-24-16-12-21(13-17-24)25(20-10-14-23(29)15-11-20)26(27)22-8-6-5-7-9-22/h5-17,29H,3-4,18-19H2,1-2H3/b26-25+
Synonyms:
  • phenol, 4-[(E)-2-chloro-1-[4-[2-(diethylamino)ethoxy]phenyl]-2-phenylethenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.