CymitQuimica logo

CAS 79838-56-5

:

E-Clomiphene N-oxide

Description:
E-Clomiphene N-oxide, with the CAS number 79838-56-5, is a chemical compound related to clomiphene, a selective estrogen receptor modulator commonly used in fertility treatments. This substance is characterized by its structural modifications that include the presence of an N-oxide functional group, which can influence its biological activity and pharmacokinetics. E-Clomiphene N-oxide is typically a white to off-white solid, and its solubility may vary depending on the solvent used. The compound exhibits properties associated with estrogenic activity, which can be relevant in the context of reproductive health. Its mechanism of action involves binding to estrogen receptors, potentially leading to altered hormonal signaling pathways. As with many chemical substances, safety and handling precautions are essential, as the compound may have specific toxicity profiles or regulatory considerations. Research into its pharmacological effects and potential applications continues, contributing to the understanding of its role in medicinal chemistry and reproductive endocrinology.
Formula:C26H28ClNO2
InChI:InChI=1S/C26H28ClNO2/c1-3-28(29,4-2)19-20-30-24-17-15-22(16-18-24)25(21-11-7-5-8-12-21)26(27)23-13-9-6-10-14-23/h5-18H,3-4,19-20H2,1-2H3/b26-25+
InChI key:InChIKey=PGHWCZITRQNIPM-OCEACIFDSA-N
SMILES:C(=C(/Cl)\C1=CC=CC=C1)(\C2=CC=C(OCCN(CC)(CC)=O)C=C2)/C3=CC=CC=C3
Synonyms:
  • Ethanamine, 2-[4-(2-chloro-1,2-diphenylethenyl)phenoxy]-N,N-diethyl-, N-oxide, (E)-
  • Ethanamine, 2-[4-[(1E)-2-chloro-1,2-diphenylethenyl]phenoxy]-N,N-diethyl-, N-oxide
  • E-Clomiphene N-oxide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.