CAS 79838-97-4
:(5E)-1-(4-fluorophenyl)-5-[(3-nitrophenyl)methylidene]-2-thioxo-3-(2,4,6-trimethylphenyl)dihydropyrimidine-4,6(1H,5H)-dione
Description:
The chemical substance known as (5E)-1-(4-fluorophenyl)-5-[(3-nitrophenyl)methylidene]-2-thioxo-3-(2,4,6-trimethylphenyl)dihydropyrimidine-4,6(1H,5H)-dione, with the CAS number 79838-97-4, is a complex organic compound characterized by its dihydropyrimidine core structure. This compound features multiple functional groups, including a thioxo group and various aromatic substituents, which contribute to its chemical reactivity and potential biological activity. The presence of the fluorophenyl and nitrophenyl groups suggests that it may exhibit interesting electronic properties and could be of interest in medicinal chemistry. The trimethylphenyl substituent adds steric bulk, which may influence the compound's interactions with biological targets. Overall, this substance may possess unique pharmacological properties, making it a candidate for further investigation in drug development or as a chemical probe in biological studies. Its structural complexity and functional diversity highlight the importance of such compounds in the field of organic and medicinal chemistry.
Formula:C26H20FN3O4S
InChI:InChI=1/C26H20FN3O4S/c1-15-11-16(2)23(17(3)12-15)29-25(32)22(14-18-5-4-6-21(13-18)30(33)34)24(31)28(26(29)35)20-9-7-19(27)8-10-20/h4-14H,1-3H3/b22-14+
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.