CAS 79844-40-9
:Benzaldehyde, 4-[(3-phenyl-2-propenyl)oxy]-, (E)-
Description:
Benzaldehyde, 4-[(3-phenyl-2-propenyl)oxy]-, (E)-, also known by its CAS number 79844-40-9, is an organic compound characterized by its aromatic structure and functional groups. It features a benzaldehyde moiety, which is a benzene ring with a formyl group (-CHO), and an allyl ether linkage with a propenyl group. This compound is typically a colorless to pale yellow liquid with a pleasant almond-like odor, characteristic of benzaldehyde derivatives. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic nature. The (E)- configuration indicates that the propenyl group is in the trans configuration relative to the benzaldehyde, influencing its reactivity and potential applications. Benzaldehyde derivatives are often utilized in the synthesis of various organic compounds, including fragrances, flavoring agents, and pharmaceuticals. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry and research. Proper handling and storage are essential due to its potential irritant properties and volatility.
Formula:C16H14O2
InChI:InChI=1S/C16H14O2/c17-13-15-8-10-16(11-9-15)18-12-4-7-14-5-2-1-3-6-14/h1-11,13H,12H2/b7-4+
InChI key:InChIKey=SRXWGYPOOZFWAD-QPJJXVBHSA-N
SMILES:O(C/C=C/C1=CC=CC=C1)C2=CC=C(C=O)C=C2
Synonyms:- Benzaldehyde, 4-[(3-phenyl-2-propenyl)oxy]-, (E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
