CAS 798544-32-8
:3-(2-Phenylethynyl)-2-pyrazinamine
Description:
3-(2-Phenylethynyl)-2-pyrazinamine is an organic compound characterized by its pyrazinamine core, which is a bicyclic structure containing nitrogen atoms. This compound features a phenylethynyl substituent, contributing to its unique properties and potential applications in medicinal chemistry. The presence of the ethynyl group enhances its reactivity and may influence its interaction with biological targets. Typically, compounds like this may exhibit interesting pharmacological activities, making them subjects of research in drug development. The molecular structure suggests potential for various functional groups, which can be modified to optimize biological activity or solubility. Additionally, the compound's stability, solubility in organic solvents, and reactivity with other chemical species are important characteristics that can affect its utility in synthetic applications or as a pharmaceutical agent. As with many organic compounds, the specific characteristics such as melting point, boiling point, and spectral properties would need to be determined experimentally or sourced from reliable databases for precise applications.
Formula:C12H9N3
InChI:InChI=1S/C12H9N3/c13-12-11(14-8-9-15-12)7-6-10-4-2-1-3-5-10/h1-5,8-9H,(H2,13,15)
InChI key:InChIKey=XPVUAIVQAYITQD-UHFFFAOYSA-N
SMILES:C(#CC1=CC=CC=C1)C=2C(N)=NC=CN2
Synonyms:- 3-(2-Phenylethynyl)-2-pyrazinamine
- Pyrazinamine, 3-(phenylethynyl)-
- 2-Pyrazinamine, 3-(2-phenylethynyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
