CAS 798545-30-9

6-Bromoquinoline-3-carboxylic acid

Description:

6-Bromoquinoline-3-carboxylic acid is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a bromine atom at the 6-position and a carboxylic acid group at the 3-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid functional group. It can participate in various chemical reactions, including electrophilic substitution and carboxylation, making it useful in synthetic organic chemistry. Additionally, the bromine substituent can enhance the compound's reactivity and serve as a handle for further functionalization. 6-Bromoquinoline-3-carboxylic acid may also exhibit biological activity, which is of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its specific applications and reactivity can vary based on the context of its use in chemical synthesis or medicinal chemistry.

Formula: C₁₀H₆BrNO₂

InChI: InChI=1/C10H6BrNO2/c11-8-1-2-9-6(4-8)3-7(5-12-9)10(13)14/h1-5H,(H,13,14)

SMILES: c1cc2c(cc(cn2)C(=O)O)cc1Br

Synonyms:

• 3-Quinolinecarboxylic Acid, 6-Bromo-
• 6-Bromoquinoline-3-carboxylicacid

6-Bromoquinoline-3-carboxylic acid

CAS: 798545-30-9

Formula: C₁₀H₆BrNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 252.0641

Ref: IN-DA004ZNV

6-Bromoquinoline-3-carboxylic acid

CAS: 798545-30-9

6-Bromoquinoline-3-carboxylic acid

Formula: C₁₀H₆BrNO₂

Purity: 97%

Color and Shape: off-white powder

Molecular weight: 252.06g/mol

Ref: 54-OR3615

6-BROMOQUINOLINE-3-CARBOXYLIC ACID

CAS: 798545-30-9

Formula: C₁₀H₆BrNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 252.067

Ref: 10-F305261