CAS 798568-24-8

3-nitroimidazo[1,2-a]pyrimidine

Description:

3-Nitroimidazo[1,2-a]pyrimidine is a heterocyclic compound characterized by its fused imidazole and pyrimidine rings, with a nitro group positioned at the 3-position of the imidazole ring. This compound typically exhibits a pale yellow to light brown appearance and is soluble in polar organic solvents. It is known for its potential biological activity, particularly in the field of medicinal chemistry, where it may exhibit antimicrobial and antitumor properties. The presence of the nitro group contributes to its reactivity and may influence its interaction with biological targets. Additionally, the structural features of 3-nitroimidazo[1,2-a]pyrimidine allow for various substitution patterns, which can be explored to enhance its pharmacological profile. As with many nitrogen-containing heterocycles, it may also participate in hydrogen bonding and π-π stacking interactions, which are crucial for its biological activity. Safety and handling precautions should be observed due to its potential toxicity and reactivity.

Formula: C₆H₄N₄O₂

InChI: InChI=1/C6H4N4O2/c11-10(12)5-4-8-6-7-2-1-3-9(5)6/h1-4H

SMILES: c1cnc2ncc(n2c1)N(=O)=O

Synonyms:

• 3-Nitroimidazo[1,2-a]pyrimidin
• Imidazo[1,2-A]Pyrimidine, 3-Nitro-

3-Nitroimidazo[1,2-a]pyrimidine

CAS: 798568-24-8

Formula: C₆H₄N₄O₂

Molecular weight: 164.1216

Ref: IN-DA004ZF7