
CAS 798578-48-0
:3-[[4-(1H-Benzimidazol-2-yl)-1,2,5-oxadiazol-3-yl]amino]propanenitrile
Description:
3-[[4-(1H-Benzimidazol-2-yl)-1,2,5-oxadiazol-3-yl]amino]propanenitrile, with the CAS number 798578-48-0, is a chemical compound characterized by its complex structure, which includes a benzimidazole moiety and an oxadiazole ring. This compound typically exhibits properties such as moderate solubility in polar solvents, which is common for compounds containing nitrogen and heterocyclic structures. It may display biological activity, potentially serving as a pharmacophore in medicinal chemistry, particularly in the development of pharmaceuticals targeting various diseases. The presence of the nitrile group suggests potential reactivity, allowing for further chemical modifications. Additionally, the compound's stability and reactivity can be influenced by the functional groups present, making it a subject of interest in both synthetic and medicinal chemistry. Overall, this compound's unique structural features contribute to its potential applications in drug discovery and development.
Formula:C12H10N6O
InChI:InChI=1S/C12H10N6O/c13-6-3-7-14-11-10(17-19-18-11)12-15-8-4-1-2-5-9(8)16-12/h1-2,4-5H,3,7H2,(H,14,18)(H,15,16)
InChI key:InChIKey=SQXFMHVFWFRLCE-UHFFFAOYSA-N
SMILES:N(CCC#N)C=1C(C=2NC=3C(N2)=CC=CC3)=NON1
Synonyms:- Propanenitrile, 3-[[4-(1H-benzimidazol-2-yl)-1,2,5-oxadiazol-3-yl]amino]-
- 3-[[4-(1H-Benzimidazol-2-yl)-1,2,5-oxadiazol-3-yl]amino]propanenitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.