CAS 79874-76-3
:Delmopinol
Description:
Delmopinol is a chemical compound primarily recognized for its application in oral hygiene products, particularly as an active ingredient in mouthwashes and dental rinses. It is classified as a surfactant and exhibits antimicrobial properties, making it effective in reducing plaque formation and gingivitis. Delmopinol functions by disrupting the biofilm formation of bacteria in the oral cavity, thereby enhancing oral health. The compound is typically presented as a colorless to pale yellow liquid and is soluble in water and alcohol, which facilitates its incorporation into aqueous formulations. Its mechanism of action involves altering the surface tension of bacterial membranes, leading to cell lysis and reduced bacterial viability. Delmopinol is generally considered safe for use in dental care products, with a favorable safety profile when used as directed. Additionally, it has been studied for its potential benefits in other therapeutic areas, although its primary use remains in dentistry. Overall, Delmopinol represents a valuable tool in the prevention of oral diseases through its unique properties and effectiveness.
Formula:C16H33NO2
InChI:InChI=1S/C16H33NO2/c1-3-6-15(7-4-2)8-5-9-16-14-19-13-11-17(16)10-12-18/h15-16,18H,3-14H2,1-2H3
InChI key:InChIKey=QSFOWAYMMZCQNF-UHFFFAOYSA-N
SMILES:C(CCC(CCC)CCC)C1N(CCO)CCOC1
Synonyms:- 2-[3-(4-Propylheptyl)Morpholin-4-Yl]Ethanol
- 3-(4-Propylheptyl)-4-(2-hydroxyethyl)morpholine
- 3-(4-Propylheptyl)-4-morpholineethanol
- 4-Morpholineethanol, 3-(4-propylheptyl)-
- Decapinol
- M 1650
- Delmopinol
- (±)-Delmopinol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
