CAS 79878-57-2
:ethyl (4-hydroxy-1,3-thiazol-2-yl)acetate
Description:
Ethyl (4-hydroxy-1,3-thiazol-2-yl)acetate is an organic compound characterized by its thiazole ring, which contains both sulfur and nitrogen atoms, contributing to its unique chemical properties. The presence of the hydroxy group (-OH) at the 4-position of the thiazole enhances its reactivity and solubility in polar solvents. As an ester, it features an ethyl group attached to the acetate moiety, which typically imparts a degree of volatility and contributes to its potential applications in organic synthesis and as a flavoring or fragrance agent. The compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests it could participate in various chemical reactions, including esterification and nucleophilic substitutions. Additionally, the thiazole ring is known for its role in various biochemical processes, which may influence the compound's interactions in biological systems. Overall, ethyl (4-hydroxy-1,3-thiazol-2-yl)acetate is a versatile compound with potential applications in both industrial and research settings.
Formula:C7H9NO3S
InChI:InChI=1/C7H9NO3S/c1-2-11-7(10)3-6-8-5(9)4-12-6/h4,9H,2-3H2,1H3
SMILES:CCOC(=O)Cc1nc(cs1)O
Synonyms:- 2-Thiazoleacetic acid, 4-hydroxy-, ethyl ester
- Ethyl (4-hydroxy-1,3-thiazol-2-yl)acetate
- OTAVA-BB BB7012670938
- CBI-BB ZERO/004598
- 2-(4-hydroxy-2-thiazolyl)acetic acid ethyl ester
- ethyl 2-(4-hydroxy-1,3-thiazol-2-yl)acetate
- AURORA 16082
- Ethyl 2-(4-hydroxythiazol-2-yl)acetate
- ETHYL (4-HYDROXY-THIAZOL-2-YL)ACETATE
- ETHYL 4-HYDROXY-2-THIAZOLEACETATE
- (4-HYDROXY-THIAZOL-2-YL)ACETIC ACID ETHYL ESTER
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(4-Hydroxy-thiazol-2-yl)acetic acid ethyl ester
CAS:Formula:C7H9NO3SColor and Shape:SolidMolecular weight:187.21
