CAS 79887-16-4
:4-n-Pentyloxyphenylacetylene
Description:
4-n-Pentyloxyphenylacetylene, with the CAS number 79887-16-4, is an organic compound characterized by its unique structure that includes a phenyl ring substituted with a pentyloxy group and an acetylene functional group. This compound typically exhibits properties associated with both aromatic and alkyne functionalities, which can influence its reactivity and physical characteristics. It is generally a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the pentyloxy group enhances its solubility in organic solvents, making it useful in various applications, including materials science and organic synthesis. Additionally, compounds like 4-n-Pentyloxyphenylacetylene may exhibit interesting optical properties, making them candidates for use in liquid crystal displays or other electronic materials. Its synthesis often involves coupling reactions, and it may be studied for its potential in developing new materials with specific electronic or photonic properties. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C13H16O
InChI:InChI=1/C13H16O/c1-3-5-6-11-14-13-9-7-12(4-2)8-10-13/h2,7-10H,3,5-6,11H2,1H3
SMILES:CCCCCOc1ccc(C#C)cc1
Synonyms:- 1-Eth-1-ynyl-4-(pentyloxy)benzene
- 1-Ethynyl-4-(Pentyloxy)Benzene
- 1-Ethynyl-4-pentyloxybenzene
- 1-Ethyl-4-(pentyloxy)benzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-n-Pentyloxyphenylacetylene, 98+%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C13H16OPurity:98+%Color and Shape:Liquid, Clear colorless to yellowMolecular weight:188.271-Eth-1-ynyl-4-(pentyloxy)benzene
CAS:Formula:C13H16OPurity:96%Color and Shape:LiquidMolecular weight:188.26551-eth-1-ynyl-4-(pentyloxy)benzene
CAS:1-eth-1-ynyl-4-(pentyloxy)benzenePurity:99%Molecular weight:188.26554g/mol1-Eth-1-ynyl-4-(pentyloxy)benzene
CAS:Formula:C13H16OPurity:96%Color and Shape:LiquidMolecular weight:188.27



