CymitQuimica logo

CAS 79887-19-7

:

1-ethynyl-4-(octyloxy)benzene

Description:
1-Ethynyl-4-(octyloxy)benzene, with the CAS number 79887-19-7, is an organic compound characterized by its unique structure that includes an ethynyl group and an octyloxy substituent attached to a benzene ring. This compound typically exhibits properties associated with both aromatic compounds and alkynes, such as stability and reactivity due to the presence of the triple bond in the ethynyl group. The octyloxy chain contributes to its hydrophobic characteristics, influencing its solubility in organic solvents while making it less soluble in water. The presence of the ethynyl group can also enhance its reactivity in various chemical reactions, such as cross-coupling reactions or polymerization processes. Additionally, this compound may exhibit interesting optical properties, making it potentially useful in applications such as organic electronics or materials science. Overall, 1-ethynyl-4-(octyloxy)benzene is a versatile compound with potential applications in various fields, including organic synthesis and material development.
Formula:C16H22O
InChI:InChI=1/C16H22O/c1-3-5-6-7-8-9-14-17-16-12-10-15(4-2)11-13-16/h2,10-13H,3,5-9,14H2,1H3
SMILES:CCCCCCCCOc1ccc(C#C)cc1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.