CAS 79888-41-8

4-Oxo-4-[(5-propyl-1,3,4-thiadiazol-2-yl)amino]butanoic acid

Description:

4-Oxo-4-[(5-propyl-1,3,4-thiadiazol-2-yl)amino]butanoic acid, with the CAS number 79888-41-8, is a chemical compound characterized by its unique structure that includes a butanoic acid moiety and a thiadiazole ring. This compound features a carbonyl group (oxo) and an amino group linked to a propyl-substituted thiadiazole, which contributes to its potential biological activity. The presence of the thiadiazole ring suggests that it may exhibit antimicrobial or antifungal properties, as many thiadiazole derivatives are known for such activities. Additionally, the carboxylic acid functional group in the butanoic acid portion may enhance its solubility in polar solvents and influence its reactivity. The compound's molecular structure allows for various interactions, making it of interest in medicinal chemistry and drug development. Its specific applications and efficacy would depend on further studies, including pharmacological evaluations and toxicity assessments. Overall, this compound represents a class of organic molecules that may have significant implications in pharmaceutical research.

Formula: C₉H₁₃N₃O₃S

InChI: InChI=1S/C9H13N3O3S/c1-2-3-7-11-12-9(16-7)10-6(13)4-5-8(14)15/h2-5H2,1H3,(H,14,15)(H,10,12,13)

InChI key: InChIKey=DGTVPQPIVDDUAL-UHFFFAOYSA-N

SMILES: N(C(CCC(O)=O)=O)C=1SC(CCC)=NN1

Synonyms:

• 3-[(5-Propyl-1,3,4-thiadiazol-2-yl)carbamoyl]propanoic acid
• 4-Oxo-4-[(5-propyl-1,3,4-thiadiazol-2-yl)amino]butanoic acid
• Butanoic acid, 4-oxo-4-[(5-propyl-1,3,4-thiadiazol-2-yl)amino]-

3-[(5-Propyl-1,3,4-thiadiazol-2-yl)carbamoyl]propanoic acid

CAS: 79888-41-8

Versatile small molecule scaffold

Formula: C₉H₁₃N₃O₃S

Purity: Min. 95%

Molecular weight: 243.29 g/mol

Ref: 3D-EDA88841