CAS 79889-39-7
:3-(imidazo[2,1-b][1,3]benzothiazol-2-yl)phenol
Description:
3-(Imidazo[2,1-b][1,3]benzothiazol-2-yl)phenol is a chemical compound characterized by its complex structure, which includes an imidazo-benzothiazole moiety and a phenolic group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry and pharmaceutical research. The presence of the imidazole and benzothiazole rings suggests that it may possess unique electronic properties and biological activities, potentially acting as a ligand or inhibitor in various biochemical pathways. Its phenolic hydroxyl group can participate in hydrogen bonding and may influence its reactivity and interaction with biological targets. The compound's CAS number, 79889-39-7, allows for easy identification and retrieval of information in chemical databases. Overall, 3-(imidazo[2,1-b][1,3]benzothiazol-2-yl)phenol represents a class of heterocyclic compounds that may have applications in drug development and other fields of chemistry.
Formula:C15H10N2OS
InChI:InChI=1/C15H10N2OS/c18-11-5-3-4-10(8-11)12-9-17-13-6-1-2-7-14(13)19-15(17)16-12/h1-9,18H
Synonyms:- 2-(3-Hydroxyphenyl)imidazo(2,1-b)benzothiazole
- Phenol, 3-imidazo(2,1-b)benzothiazol-2-yl-
- phenol, 3-imidazo[2,1-b]benzothiazol-2-yl-
- 3-Imidazo(2,1-b)benzothiazol-2-ylphenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
YM 11124
CAS:<p>YM 11124 is a biochemical.</p>Formula:C15H10N2OSColor and Shape:SolidMolecular weight:266.32
