CymitQuimica logo

CAS 79890-07-6

:

3-imidazo[2,1-b][1,3]benzothiazol-2-ylaniline

Description:
3-Imidazo[2,1-b][1,3]benzothiazol-2-ylaniline is a heterocyclic compound characterized by its complex structure, which includes an imidazole ring fused to a benzothiazole moiety and an aniline group. This compound typically exhibits properties associated with both aromatic and heteroaromatic systems, such as stability and potential for diverse chemical reactivity. It may display biological activity, making it of interest in medicinal chemistry, particularly for its potential as a pharmacophore in drug development. The presence of nitrogen and sulfur atoms in its structure can influence its solubility, polarity, and interaction with biological targets. Additionally, the compound may exhibit fluorescence properties, which can be useful in various applications, including imaging and sensing. Its synthesis often involves multi-step organic reactions, and it may be characterized using techniques such as NMR spectroscopy, mass spectrometry, and X-ray crystallography to confirm its structure and purity. Overall, 3-imidazo[2,1-b][1,3]benzothiazol-2-ylaniline represents a class of compounds with significant potential in both research and application.
Formula:C15H11N3S
InChI:InChI=1/C15H11N3S/c16-11-5-3-4-10(8-11)12-9-18-13-6-1-2-7-14(13)19-15(18)17-12/h1-9H,16H2
Synonyms:
  • benzenamine, 3-imidazo[2,1-b]benzothiazol-2-yl-
  • 3-(Imidazo[2,1-b][1,3]benzothiazol-2-yl)aniline
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.