CAS 79896-32-5
:(1R,4S)-4-(3,4-Dichlorophenyl)-1,2,3,4-tetrahydro-N-methyl-1-naphthalenamine hydrochloride (1:1)
Description:
(1R,4S)-4-(3,4-Dichlorophenyl)-1,2,3,4-tetrahydro-N-methyl-1-naphthalenamine hydrochloride is a chemical compound characterized by its complex structure, which includes a naphthalene ring system and a dichlorophenyl group. This compound features a tetrahydro configuration, indicating the presence of a saturated cyclic structure, and it is a chiral molecule, as denoted by the (1R,4S) stereochemistry. The presence of the N-methyl group suggests that it is a derivative of a naphthylamine, which can influence its biological activity and solubility. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for pharmaceutical applications. The compound may exhibit various pharmacological properties, potentially including effects on the central nervous system, given its structural similarities to other psychoactive substances. However, specific biological activities and safety profiles would require further investigation through empirical studies.
Formula:C17H17Cl2N·ClH
InChI:InChI=1S/C17H17Cl2N.ClH/c1-20-17-9-7-12(13-4-2-3-5-14(13)17)11-6-8-15(18)16(19)10-11;/h2-6,8,10,12,17,20H,7,9H2,1H3;1H/t12-,17+;/m0./s1
InChI key:InChIKey=BLFQGGGGFNSJKA-LWHGMNCYSA-N
SMILES:N(C)[C@H]1C=2C([C@@H](CC1)C3=CC(Cl)=C(Cl)C=C3)=CC=CC2.Cl
Synonyms:- 1-Naphthalenamine, 4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-N-methyl-, hydrochloride (1:1), (1R,4S)-
- 1-Naphthalenamine, 4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-N-methyl-, hydrochloride, (1R-trans)-
- (1R,4S)-4-(3,4-Dichlorophenyl)-1,2,3,4-tetrahydro-N-methyl-1-naphthalenamine hydrochloride (1:1)
- 1-Naphthalenamine, 4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-N-methyl-, hydrochloride, (1R,4S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
(1R,4S)-Sertraline Hydrochloride
CAS:Formula:C17H18Cl3NColor and Shape:SolidMolecular weight:342.6905(1R,4S)-Sertraline HCl
CAS:Formula:C17H17Cl2N·HClColor and Shape:White To Off-White SolidMolecular weight:306.24 36.46



