CAS 79899-04-0

5-Methyl-2-(1-methylethyl)-3H-imidazo[4,5-b]pyridin-7-ol

Description:

5-Methyl-2-(1-methylethyl)-3H-imidazo[4,5-b]pyridin-7-ol, with the CAS number 79899-04-0, is a heterocyclic organic compound characterized by its imidazo[4,5-b]pyridine structure, which incorporates both nitrogen and carbon atoms in its ring system. This compound features a methyl group and an isopropyl group, contributing to its unique chemical properties and potential biological activity. The presence of a hydroxyl group at the 7-position enhances its solubility in polar solvents and may influence its reactivity and interaction with biological targets. Typically, compounds of this class are studied for their pharmacological properties, including potential roles as pharmaceuticals or agrochemicals. The molecular structure suggests that it may exhibit interesting electronic properties due to the conjugation within the aromatic system. Additionally, the compound's stability, reactivity, and potential applications can be influenced by the substituents on the imidazo and pyridine rings, making it a subject of interest in medicinal chemistry and drug development.

Formula: C₁₀H₁₃N₃O

InChI: InChI=1S/C10H13N3O/c1-5(2)9-12-8-7(14)4-6(3)11-10(8)13-9/h4-5H,1-3H3,(H2,11,12,13,14)

InChI key: InChIKey=ROJDUTZWNZYODX-UHFFFAOYSA-N

SMILES: OC1=C2C(N=C(C(C)C)N2)=NC(C)=C1

Synonyms:

• 3H-Imidazo[4,5-b]pyridin-7-ol, 5-methyl-2-(1-methylethyl)-
• 5-Methyl-2-(1-methylethyl)-3H-imidazo[4,5-b]pyridin-7-ol
• 2-Isopropyl-5-methyl-3H-imidazo[4,5-b]pyridin-7-ol
• 1H-Imidazo[4,5-b]pyridin-7-ol, 5-methyl-2-(1-methylethyl)-