CymitQuimica logo

CAS 79909-92-5

:

Methyl 4-amino-2,6-dimethylbenzoate

Description:
Methyl 4-amino-2,6-dimethylbenzoate, with the CAS number 79909-92-5, is an organic compound that belongs to the class of benzoate esters. It features a methyl ester functional group attached to a benzoic acid derivative, which is further substituted with amino and methyl groups. This compound typically appears as a solid or liquid, depending on its purity and specific conditions. It is characterized by its aromatic structure, which contributes to its chemical stability and potential reactivity. The presence of the amino group can impart basic properties, while the methyl groups enhance its hydrophobic characteristics. Methyl 4-amino-2,6-dimethylbenzoate may be utilized in various applications, including pharmaceuticals and agrochemicals, due to its potential biological activity. As with many organic compounds, it is important to handle it with care, observing appropriate safety protocols to mitigate any risks associated with its use. Its solubility, melting point, and other physical properties can vary based on environmental conditions and purity levels.
Formula:C10H13NO2
InChI:InChI=1S/C10H13NO2/c1-6-4-8(11)5-7(2)9(6)10(12)13-3/h4-5H,11H2,1-3H3
InChI key:XSDROOHFZHGXIX-UHFFFAOYSA-N
SMILES:CC1=CC(=CC(=C1C(=O)OC)C)N
Found 5 products.