CAS 79917-88-7

1,3-dimethyl-1H-imidazol-3-ium chloride

Description:

1,3-Dimethyl-1H-imidazol-3-ium chloride is an organic compound characterized by its imidazolium structure, which features a five-membered aromatic ring containing two nitrogen atoms. This compound is typically a white to off-white solid at room temperature and is soluble in polar solvents such as water and alcohols, making it useful in various applications, including as an ionic liquid. The presence of the dimethyl groups enhances its solubility and stability. As a quaternary ammonium salt, it exhibits ionic characteristics, which contribute to its conductivity and potential use in electrochemical applications. Additionally, it can act as a catalyst or solvent in organic synthesis and is of interest in the field of green chemistry due to its low volatility and reduced environmental impact compared to traditional solvents. Its chloride anion can participate in various chemical reactions, making it versatile in synthetic chemistry. Overall, 1,3-dimethyl-1H-imidazol-3-ium chloride is notable for its unique structural features and functional properties.

Formula: C₅H₉ClN₂

InChI: InChI=1/C5H9N2.ClH/c1-6-3-4-7(2)5-6;/h3-5H,1-2H3;1H/q+1;/p-1

Synonyms:

• 1,3-Dimethylimidazolium Chloride
• 1H-imidazolium, 1,3-dimethyl-, chloride (1:1)
• 1,3-Dimethyl-1H-imidazol-3-ium chloride
• 1,3-DimethylimidazoliumChloride,98%
• [C1MIm]Cl
• 1,3-DimethylimidazoliumChloride&gt
• 1,3-Dimethyl-3-imidazolium Chloride

1,3-Dimethylimidazolium Chloride

CAS: 79917-88-7

Formula: C₅H₉ClN₂

Purity: >98.0%(T)

Color and Shape: White to Almost white powder to crystal

Molecular weight: 132.59

Ref: 3B-D3341

1,3-Dimethylimidazolium Chloride

CAS: 79917-88-7

Formula: C₅H₉ClN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 132.5914

Ref: IN-DA0032LW

1,3-Dimethyl-1H-imidazol-3-ium chloride

CAS: 79917-88-7

1,3-Dimethyl-1H-imidazol-3-ium chloride

Purity: 97%

Molecular weight: 132.59g/mol

Ref: 54-OR74067

1,3-Dimethyl-1H-imidazol-3-ium chloride

CAS: 79917-88-7

Formula: C₅H₉ClN₂

Purity: 95%

Color and Shape: Solid, White to very pale yellow powder

Molecular weight: 132.59

Ref: 10-F240138