CymitQuimica logo

CAS 79925-03-4

:

4-(3-Nitrophenyl)-3-thiosemicarbazide

Description:
4-(3-Nitrophenyl)-3-thiosemicarbazide is an organic compound characterized by the presence of a thiosemicarbazide functional group, which is known for its diverse biological activities. This compound features a nitrophenyl group, contributing to its potential as a pharmacophore in medicinal chemistry. The thiosemicarbazide moiety typically exhibits properties such as chelation with metal ions and the ability to form various derivatives, which can enhance its biological efficacy. The presence of the nitro group can influence the compound's reactivity and solubility, as well as its interaction with biological targets. Additionally, thiosemicarbazides are often studied for their antimicrobial, anticancer, and anti-inflammatory properties. The compound's molecular structure allows for potential applications in drug development and as a research tool in biochemistry. As with many organic compounds, its stability, solubility, and reactivity can vary based on environmental conditions and the presence of other chemical species. Proper handling and safety measures should be observed due to the potential toxicity associated with nitro-substituted compounds.
Formula:C7H8N4O2S
InChI:InChI=1/C7H8N4O2S/c8-10-7(14)9-5-2-1-3-6(4-5)11(12)13/h1-4H,8H2,(H2,9,10,14)
SMILES:c1cc(cc(c1)N(=O)=O)N=C(NN)S
Synonyms:
  • N-(3-nitrophenyl)hydrazinecarbothioamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.