CAS 799258-42-7
:2-Methyl-5-oxo-5-(2-thiazolylamino)pentanoic acid
Description:
2-Methyl-5-oxo-5-(2-thiazolylamino)pentanoic acid is a chemical compound characterized by its unique structure, which includes a thiazole ring and a pentanoic acid backbone. This compound features a ketone functional group and an amino group, contributing to its potential reactivity and biological activity. The presence of the thiazole moiety often indicates potential pharmacological properties, as thiazoles are commonly found in various bioactive compounds. The compound is likely to be soluble in polar solvents due to the carboxylic acid group, while its overall polarity may vary based on the substituents. Its molecular structure suggests it may participate in hydrogen bonding, influencing its interactions in biological systems. Additionally, the compound may exhibit specific stereochemical properties, which can affect its biological activity and interactions with enzymes or receptors. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and potential applications in medicinal chemistry or other fields.
Formula:C9H12N2O3S
InChI:InChI=1S/C9H12N2O3S/c1-6(8(13)14)2-3-7(12)11-9-10-4-5-15-9/h4-6H,2-3H2,1H3,(H,13,14)(H,10,11,12)
InChI key:InChIKey=OONRYWBUICKQEV-UHFFFAOYSA-N
SMILES:N(C(CCC(C(O)=O)C)=O)C1=NC=CS1
Synonyms:- Pentanoic acid, 2-methyl-5-oxo-5-(2-thiazolylamino)-
- 2-Methyl-5-oxo-5-(2-thiazolylamino)pentanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.