CymitQuimica logo

CAS 799260-52-9

:

1-Methyl-N-[3-(1-methylethoxy)propyl]-4-piperidinamine

Description:
1-Methyl-N-[3-(1-methylethoxy)propyl]-4-piperidinamine, identified by its CAS number 799260-52-9, is a chemical compound characterized by its piperidine structure, which includes a methyl group and a propyl chain with an ethoxy substituent. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds due to the presence of the amine functional group. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as piperidine derivatives are often found in biologically active compounds. The presence of the 1-methylethoxy group may influence its solubility and lipophilicity, impacting its pharmacokinetic properties. Additionally, the compound's stability, reactivity, and interaction with biological targets would depend on its specific stereochemistry and functional groups. Overall, while detailed physical and chemical properties such as melting point, boiling point, and solubility are not provided, the structural characteristics indicate its relevance in chemical research and potential therapeutic applications.
Formula:C12H26N2O
InChI:InChI=1S/C12H26N2O/c1-11(2)15-10-4-7-13-12-5-8-14(3)9-6-12/h11-13H,4-10H2,1-3H3
InChI key:InChIKey=VFERUZKEIMQACS-UHFFFAOYSA-N
SMILES:N(CCCOC(C)C)C1CCN(C)CC1
Synonyms:
  • 1-Methyl-N-[3-(1-methylethoxy)propyl]-4-piperidinamine
  • 4-Piperidinamine,1-methyl-N-[3-(1-methylethoxy)propyl]-(9CI)
  • 4-Piperidinamine, 1-methyl-N-[3-(1-methylethoxy)propyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.