CAS 799262-38-7
:4-(5-Methyl-1H-tetrazol-1-yl)benzeneacetic acid
Description:
4-(5-Methyl-1H-tetrazol-1-yl)benzeneacetic acid, with the CAS number 799262-38-7, is a chemical compound characterized by its unique structure that includes a benzene ring substituted with a tetrazole group and an acetic acid moiety. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of the carboxylic acid functional group. The tetrazole ring contributes to its potential biological activity, as tetrazoles are known for their pharmacological properties, including antimicrobial and anti-inflammatory effects. The presence of the methyl group on the tetrazole enhances its lipophilicity, which may influence its interaction with biological targets. Additionally, the compound may participate in various chemical reactions, including esterification and amidation, due to the reactive carboxylic acid group. Overall, 4-(5-Methyl-1H-tetrazol-1-yl)benzeneacetic acid is of interest in medicinal chemistry and drug development, warranting further investigation into its potential applications.
Formula:C10H10N4O2
InChI:InChI=1S/C10H10N4O2/c1-7-11-12-13-14(7)9-4-2-8(3-5-9)6-10(15)16/h2-5H,6H2,1H3,(H,15,16)
InChI key:InChIKey=JFLVCYOJCVLGDE-UHFFFAOYSA-N
SMILES:CC=1N(C2=CC=C(CC(O)=O)C=C2)N=NN1
Synonyms:- 2-(4-(5-Methyl-1H-tetrazol-1-yl)phenyl)acetic acid
- 2-[4-(5-Methyl-1H-1,2,3,4-tetrazol-1-yl)phenyl]acetic acid
- 2-[4-(5-Methyltetrazol-1-yl)phenyl]acetic acid
- 4-(5-Methyl-1H-tetrazol-1-yl)benzeneacetic acid
- Benzeneacetic acid, 4-(5-methyl-1H-tetrazol-1-yl)-
- [4-(5-Methyltetrazol-1-yl)phenyl]acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
