CAS 799266-56-1
:4-(1,3-dihydro-2H-isoindol-2-yl)butanoic acid
Description:
4-(1,3-Dihydro-2H-isoindol-2-yl)butanoic acid, with the CAS number 799266-56-1, is an organic compound characterized by its unique structure that includes an isoindole moiety and a butanoic acid functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, which can influence its solubility and reactivity. It is likely to be a solid at room temperature, with potential applications in medicinal chemistry due to its structural features that may interact with biological targets. The presence of the carboxylic acid group suggests it can participate in acid-base reactions and form salts or esters. Additionally, the isoindole structure may contribute to its potential as a pharmacophore in drug design. Overall, this compound's characteristics make it a subject of interest for further research in various chemical and biological contexts.
Formula:C12H15NO2
InChI:InChI=1/C12H15NO2/c14-12(15)6-3-7-13-8-10-4-1-2-5-11(10)9-13/h1-2,4-5H,3,6-9H2,(H,14,15)
SMILES:c1ccc2CN(CCCC(=O)O)Cc2c1
Synonyms:- 2H-Isoindole-2-butanoic acid, 1,3-dihydro-
- 4-(1,3-Dihydro-2H-isoindol-2-yl)butanoic acid
- TIMTEC-BB SBB011109
- CHEMBRDG-BB 4003157
- 4-(1,3-DIHYDRO-ISOINDOL-2-YL)-BUTYRIC ACID
- 4-(1,3-dihydro-2H-isoindol-2-yl)butanoic acid(SALTDATA: HCl)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.