CAS 799274-08-1

6-Fluoro-1,2,3,4-tetrahydroisoquinoline hydrochloride

Description:

6-Fluoro-1,2,3,4-tetrahydroisoquinoline hydrochloride is a chemical compound characterized by its tetrahydroisoquinoline structure, which is a bicyclic compound featuring a fused benzene and piperidine ring. The presence of a fluorine atom at the 6-position contributes to its unique chemical properties, potentially influencing its reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. This compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry, particularly in the development of drugs targeting neurological or psychiatric disorders. Its molecular structure allows for interactions with biological targets, and the fluorine substitution can enhance metabolic stability and lipophilicity. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity. Further research is often necessary to fully elucidate its biological effects and therapeutic potential.

Formula: C₉H₁₁ClFN

InChI: InChI=1/C9H10FN.ClH/c10-9-2-1-8-6-11-4-3-7(8)5-9;/h1-2,5,11H,3-4,6H2;1H

SMILES: c1cc(cc2CCNCc12)F.Cl

6-Fluoro-1,2,3,4-tetrahydroisoquinoline hydrochloride

CAS: 799274-08-1

Formula: C₉H₁₁ClFN

Purity: 97%

Color and Shape: Solid

Molecular weight: 187.6417

Ref: IN-DA0036K2

6-Fluoro-1,2,3,4-tetrahydroisoquinoline hydrochloride

CAS: 799274-08-1

6-Fluoro-1,2,3,4-tetrahydroisoquinoline hydrochloride

Purity: 95%

Color and Shape: Off-White Solid

Molecular weight: 187.64g/mol

Ref: 54-PC53191

6-Fluoro-1,2,3,4-tetrahydroisoquinoline hydrochloride

CAS: 799274-08-1

Formula: C₉H₁₁ClFN

Purity: 97%

Color and Shape: Solid

Molecular weight: 187.64

Ref: 10-F225132