CAS 799283-97-9

4-isocyanato-5-methyl-1-phenyl-1H-pyrazole

Description:

4-Isocyanato-5-methyl-1-phenyl-1H-pyrazole is an organic compound characterized by its isocyanate functional group, which is known for its reactivity and ability to form stable urea derivatives. This compound features a pyrazole ring, a five-membered heterocyclic structure containing two nitrogen atoms, which contributes to its unique chemical properties. The presence of a methyl group and a phenyl group enhances its hydrophobic characteristics and may influence its solubility in organic solvents. As an isocyanate, it is likely to participate in nucleophilic addition reactions, making it useful in the synthesis of various polymers and pharmaceuticals. Additionally, compounds with isocyanate groups are often associated with potential health hazards, including respiratory irritation and sensitization, necessitating careful handling. Overall, 4-isocyanato-5-methyl-1-phenyl-1H-pyrazole is a versatile compound with applications in materials science and medicinal chemistry, though safety precautions are essential due to its reactive nature.

Formula: C₁₁H₉N₃O

InChI: InChI=1/C11H9N3O/c1-9-11(12-8-15)7-13-14(9)10-5-3-2-4-6-10/h2-7H,1H3

SMILES: Cc1c(cnn1c1ccccc1)N=C=O

Synonyms:

• 5-methyl-1-phenyl-1H-pyrazol-4-yl isocyanate

4-Isocyanato-5-methyl-1-phenyl-1H-pyrazole

CAS: 799283-97-9

4-Isocyanato-5-methyl-1-phenyl-1H-pyrazole

Purity: 97%

Color and Shape: Off-White Solid

Molecular weight: 199.21g/mol

Ref: 54-OR6719