CAS 79932-20-0

4-(1-methylethyl)-1,3-thiazol-2-amine

Description:

4-(1-Methylethyl)-1,3-thiazol-2-amine, identified by its CAS number 79932-20-0, is an organic compound featuring a thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound typically exhibits characteristics common to thiazole derivatives, such as potential biological activity and the ability to participate in various chemical reactions due to the presence of the amine group. The isopropyl group (1-methylethyl) attached to the thiazole ring can influence its solubility and reactivity, making it potentially useful in pharmaceutical applications or as a building block in organic synthesis. The presence of the amine functional group suggests that it may engage in hydrogen bonding, affecting its interactions with other molecules. Overall, this compound's unique structure may confer specific properties that could be explored in various chemical and biological contexts, although detailed studies would be necessary to fully elucidate its behavior and potential applications.

Formula: C₆H₁₀N₂S

InChI: InChI=1/C6H10N2S/c1-4(2)5-3-9-6(7)8-5/h3-4H,1-2H3,(H2,7,8)

SMILES: CC(C)c1csc(=N)[nH]1

Synonyms:

• 2-Thiazolamine, 4-(1-Methylethyl)-
• 4-Isopropyl-1,3-thiazol-2-amine

4-isopropylthiazol-2-amine

CAS: 79932-20-0

Formula: C₆H₁₀N₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 142.2220

Ref: IN-DA003GFH

4-Isopropyl-1,3-thiazol-2-amine

CAS: 79932-20-0

4-Isopropyl-1,3-thiazol-2-amine

Purity: 98%

Molecular weight: 142.22g/mol

Ref: 54-OR965018

4-Isopropyl-thiazol-2-ylamine

CAS: 79932-20-0

Formula: C₆H₁₀N₂S

Purity: 98%

Color and Shape: Solid, Crystalline

Molecular weight: 142.22

Ref: 10-F060804

4-Isopropyl-1,3-thiazol-2-amine

Controlled Product

CAS: 79932-20-0

Applications 4-Isopropyl-1,3-thiazol-2-amine
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package

Formula: C₆H₁₀N₂S

Color and Shape: Neat

Molecular weight: 142.22

Ref: TR-I874413