CAS 79943-68-3
:hydra peptide
Description:
Hydra peptide, identified by the CAS number 79943-68-3, is a synthetic peptide that is often utilized in cosmetic formulations for its potential skin benefits. Characteristically, it is known for its ability to enhance skin hydration, improve elasticity, and promote a more youthful appearance. The peptide works by stimulating collagen production and supporting the skin's natural barrier function, which can help reduce the appearance of fine lines and wrinkles. Hydra peptide is typically soluble in water, making it suitable for incorporation into various topical products such as serums, creams, and lotions. Its molecular structure allows it to penetrate the skin effectively, delivering its beneficial effects at a cellular level. Additionally, it is generally considered safe for topical use, with a low risk of irritation, making it appealing for a wide range of skin types. As with any cosmetic ingredient, it is advisable to conduct a patch test prior to widespread use to ensure compatibility with individual skin sensitivities.
Formula:C54H84N12O14
InChI:InChI=1/C54H84N12O14/c1-7-32(6)45(51(76)61-36(25-30(2)3)47(72)62-37(54(79)80)26-33-15-9-8-10-16-33)64-50(75)44(31(4)5)63-46(71)34(17-11-12-22-55)60-48(73)38(29-67)59-43(70)28-56-42(69)27-57-49(74)39-18-13-23-65(39)53(78)40-19-14-24-66(40)52(77)35-20-21-41(68)58-35/h8-10,15-16,30-32,34-40,44-45,67H,7,11-14,17-29,55H2,1-6H3,(H,56,69)(H,57,74)(H,58,68)(H,59,70)(H,60,73)(H,61,76)(H,62,72)(H,63,71)(H,64,75)(H,79,80)/t32-,34-,35-,36-,37-,38-,39-,40-,44-,45-/m0/s1
SMILES:CC[C@H](C)[C@@H](C(=N[C@@H](CC(C)C)C(=N[C@@H](Cc1ccccc1)C(=O)O)O)O)N=C([C@H](C(C)C)N=C([C@H](CCCCN)N=C([C@H](CO)N=C(CN=C(CN=C([C@@H]1CCCN1C(=O)[C@@H]1CCCN1C(=O)[C@@H]1CCC(=N1)O)O)O)O)O)O)O
Synonyms:- Head activator peptide
- Hhap
- Hydra growth activator
- Hydra head activator peptide
- Peptide head activator
- Peptide hydra morphogen
- Pglu-pro-pro-gly-gly-ser-lys-val-ile-leu-phe
- Pyroglutamyl-prolyl-prolyl-glycyl-glycyl-seryl-lysyl-valyl-isoleucyl-leucyl-phenylalanine
- Peptide (hydra head-activator)
- 5-oxo-L-prolyl-L-prolyl-L-prolylglycylglycyl-L-seryl-L-lysyl-L-valyl-L-isoleucyl-L-leucyl-L-phenylalanine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Head activator
CAS:Morphogenic peptide from hydra. The neuropeptide head activator is a high-affinity ligand for the orphan G-protein-coupled receptor GPR37.Formula:C54H84N12O14Purity:98.0%Molecular weight:1125.33Head Activator
CAS:Head activator Pyr-Pro-Pro-Gly-Gly-Ser-Lys-Val-Ile-Leu-Phe-OH is a synthetic peptide, which is modeled after bioactive peptides found in certain biological systems. It is derived from the head activator peptides naturally occurring in organisms like hydra and is believed to play a role in neurochemical signaling pathways.The mode of action of this peptide involves the modulation of neuronal activity and proliferation through specific interactions with cellular receptors, influencing processes such as cell growth and differentiation. These interactions may contribute to neuroprotection and support neural regeneration, making it a subject of interest in neurobiological research.Given its role in cellular signaling, Head activator Pyr-Pro-Pro-Gly-Gly-Ser-Lys-Val-Ile-Leu-Phe-OH is primarily used in research contexts, especially in studies focusing on neurobiology, regenerative medicine, and the molecular mechanisms underlying neural development. Its ability to mimic certain endogenous signaling processes allows scientists to explore the regulation of neural cell behavior and the potential therapeutic applications for neurodegenerative conditions.Formula:C54H84N12O14Purity:Min. 95%Molecular weight:1,125.32 g/mol

