CAS 79944-64-2
:(3-Chloro-5-fluorophenyl)methanol
Description:
(3-Chloro-5-fluorophenyl)methanol is an organic compound characterized by the presence of a phenolic structure with both chlorine and fluorine substituents. The compound features a hydroxymethyl group (-CH2OH) attached to a phenyl ring, which enhances its reactivity and solubility in polar solvents. The chlorine atom is located at the meta position (3-position) and the fluorine atom at the para position (5-position) relative to the hydroxymethyl group on the aromatic ring, influencing its electronic properties and potential interactions in chemical reactions. This compound may exhibit interesting biological activities due to the presence of halogen substituents, which can affect its lipophilicity and binding affinity to biological targets. Additionally, (3-Chloro-5-fluorophenyl)methanol can be utilized in various synthetic applications, including the development of pharmaceuticals and agrochemicals. Its unique structure allows for potential modifications that can lead to derivatives with enhanced properties or activities. Safety data should be consulted for handling and storage, as halogenated compounds can pose specific health and environmental risks.
Formula:C7H6ClFO
InChI:InChI=1/C7H6ClFO/c8-6-1-5(4-10)2-7(9)3-6/h1-3,10H,4H2
SMILES:c1c(cc(cc1Cl)F)CO
Synonyms:- 3-Chloro-5-fluorobenzenemethanol
- 3-Chloro-5-fluorobenzyl alcohol
- Benzenemethanol, 3-chloro-5-fluoro-
- Q1R Cg Ef
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Chloro-5-fluorobenzyl alcohol, 98+%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H6ClFOPurity:98+%Color and Shape:Clear colorless, LiquidMolecular weight:160.583-CHLORO-5-FLUOROBENZYL ALCOHOL
CAS:Formula:C7H6ClFOPurity:98%Color and Shape:LiquidMolecular weight:160.57333-Chloro-5-fluorobenzyl alcohol
CAS:3-Chloro-5-fluorobenzyl alcoholFormula:C7H6ClFOPurity:≥95%Color and Shape:LiquidMolecular weight:160.57g/mol3-Chloro-5-fluorobenzyl alcohol
CAS:Formula:C7H6ClFOPurity:98%Color and Shape:LiquidMolecular weight:160.57



