CAS 79953-02-9

2-amino-8-[(E)-(4-bromophenyl)diazenyl]-3,5-dihydro-6H-purin-6-one

Description:

2-amino-8-[(E)-(4-bromophenyl)diazenyl]-3,5-dihydro-6H-purin-6-one, with the CAS number 79953-02-9, is a chemical compound that belongs to the purine family, characterized by its bicyclic structure comprising a fused imidazole and pyrimidine ring. This compound features an amino group at the 2-position and a diazenyl group at the 8-position, which contributes to its potential reactivity and biological activity. The presence of the bromophenyl moiety enhances its lipophilicity and may influence its interactions with biological targets. The compound is likely to exhibit properties typical of azo compounds, such as potential colorimetric characteristics and reactivity under certain conditions. Its structural features suggest possible applications in medicinal chemistry, particularly in the development of pharmaceuticals or as a dye. However, specific properties such as solubility, melting point, and stability would require empirical determination or literature reference for precise characterization. Overall, this compound represents a unique intersection of purine chemistry and azo dye chemistry, warranting further investigation for its potential applications.

Formula: C₁₁H₈BrN₇O

InChI: InChI=1/C11H8BrN7O/c12-5-1-3-6(4-2-5)18-19-11-14-7-8(16-11)15-10(13)17-9(7)20/h1-4,7H,(H3,13,14,15,16,17,20)/b19-18+

2-Amino-8-[(4-bromophenyl)azo]-1,7-dihydro-6H-purin-6-one-13C2,15N

Controlled Product

CAS: 79953-02-9

Applications 2-Amino-8-[(4-bromophenyl)azo]-1,7-dihydro-6H-purin-6-one-13C2,15N is an intermediate in synthesizing 8-Aminoguanine-13C2,15N (A609862), which is an isotope labelled compound of 8-Aminoguanine (A609875) that accelerates DNA tetramolecular G-quadruplex formation.
References Gros, J., et al.: J. Chem. Commun., 25, 2926 (2008)

Formula: C₂C₉H₈Br₁₅NN₆O

Color and Shape: Neat

Molecular weight: 337.11

Ref: TR-A601754