CAS 79971-08-7
:3',5'-di-O-butanoyl-2'-deoxyguanosine
Description:
3',5'-di-O-butanoyl-2'-deoxyguanosine is a modified nucleoside derivative of deoxyguanosine, characterized by the presence of two butanoyl (butyric acid) groups esterified at the 3' and 5' hydroxyl positions of the sugar moiety. This modification enhances the lipophilicity of the molecule, potentially influencing its biological activity and cellular uptake. The compound retains the purine base structure of guanosine, which is essential for its role in nucleic acid synthesis and function. As a nucleoside analog, it may exhibit unique interactions with nucleic acid polymerases or other biomolecules, making it of interest in biochemical research and potential therapeutic applications. The presence of the butanoyl groups can also affect the stability and solubility of the compound in various solvents. Overall, 3',5'-di-O-butanoyl-2'-deoxyguanosine serves as a valuable tool in the study of nucleic acid chemistry and may have implications in drug design and development.
Formula:C18H25N5O6
InChI:InChI=1/C18H25N5O6/c1-3-5-13(24)27-8-11-10(29-14(25)6-4-2)7-12(28-11)23-9-20-15-16(23)21-18(19)22-17(15)26/h9-12H,3-8H2,1-2H3,(H3,19,21,22,26)/t10-,11+,12+/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2'-Deoxyguanosine 3’,5’-Dibutanoate
CAS:Controlled ProductApplications 2'-Deoxyguanosine 3’,5’-Dibutanoate is an intermediate in the synthesis of DNA adducts of Aflatoxin B1 (A357460).
References Brown, K.L., et al.: J. Am. Chem. Soc., 128, 15188 (2006);Formula:C18H25N5O6Color and Shape:NeatMolecular weight:407.421
