CAS 79990-06-0

benzyl [2-(diethylamino)-2-oxoethyl]carbamate

Description:

Benzyl [2-(diethylamino)-2-oxoethyl]carbamate, identified by its CAS number 79990-06-0, is a chemical compound that features a carbamate functional group, which is characterized by the presence of an amine and a carbonyl group. This compound typically exhibits properties associated with both amines and carbamates, such as moderate solubility in organic solvents and potential reactivity with acids and bases. The presence of the diethylamino group suggests that it may have basic properties, while the benzyl group can contribute to its lipophilicity, potentially influencing its biological activity and interaction with cellular membranes. The compound may be used in various applications, including pharmaceuticals and agrochemicals, due to its ability to act as a building block in organic synthesis. Additionally, its structure may allow for specific interactions with biological targets, making it of interest in medicinal chemistry. As with many organic compounds, safety and handling precautions should be observed, as it may pose health risks if not managed properly.

Formula: C₁₄H₂₀N₂O₃

InChI: InChI=1/C14H20N2O3/c1-3-16(4-2)13(17)10-15-14(18)19-11-12-8-6-5-7-9-12/h5-9H,3-4,10-11H2,1-2H3,(H,15,18)

SMILES: CCN(CC)C(=O)CN=C(O)OCc1ccccc1

Synonyms:

• carbamic acid, N-[2-(diethylamino)-2-oxoethyl]-, phenylmethyl ester