CAS 79996-89-7

4-Chloro-1-naphthalenemethanol

Description:

4-Chloro-1-naphthalenemethanol is an organic compound characterized by the presence of a naphthalene ring substituted with a chlorine atom and a hydroxymethyl group. Its molecular structure features a naphthalene backbone, which consists of two fused benzene rings, providing it with significant aromatic stability. The chlorine substituent at the 4-position introduces both electronegative character and potential for further chemical reactivity, while the hydroxymethyl group (-CH2OH) contributes to its polar nature, enhancing solubility in polar solvents. This compound is typically a solid at room temperature and may exhibit moderate to low volatility. Its chemical properties allow for various reactions, including nucleophilic substitutions and oxidation, making it of interest in synthetic organic chemistry. Additionally, the presence of both a halogen and a hydroxyl group suggests potential applications in pharmaceuticals or as intermediates in chemical synthesis. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling procedures should be followed.

Formula: C₁₁H₉ClO

InChI: InChI=1S/C11H9ClO/c12-11-6-5-8(7-13)9-3-1-2-4-10(9)11/h1-6,13H,7H2

InChI key: InChIKey=YJGYJNTZRNCUIG-UHFFFAOYSA-N

SMILES: C(O)C=1C2=C(C(Cl)=CC1)C=CC=C2

Synonyms:

• 4-Chloro-1-naphthalenemethanol
• (4-Chloronaphthalen-1-yl)methanol
• 1-Naphthalenemethanol, 4-chloro-

(4-Chloronaphthalen-1-yl)methanol

CAS: 79996-89-7

Versatile small molecule scaffold

Formula: C₁₁H₉ClO

Purity: Min. 95%

Molecular weight: 192.64 g/mol

Ref: 3D-EDA99689